C19H21N3O5 — CID 97130223
(3S)-3-(cyclopropylmethyl)-1-(2,3-dioxo-1,4-dihydroquinoxaline-6-carbonyl)piperidine-3-carboxylic acid (PubChem CID 97130223) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (3S)-3-(cyclopropylmethyl)-1-(2,3-dioxo-1,4-dihydroquinoxaline-6-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-(cyclopropylmethyl)-1-(2,3-dioxo-1,4-dihydroquinoxaline-6-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97130223 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3S)-3-(cyclopropylmethyl)-1-(2,3-dioxo-1,4-dihydroquinoxaline-6-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(c1ccc2[nH]c(=O)c(=O)[nH]c2c1)N1CCC[C@@](CC2CC2)(C(=O)O)C1 |
| InChI | InChI=1S/C19H21N3O5/c23-15-16(24)21-14-8-12(4-5-13(14)20-15)17(25)22-7-1-6-19(10-22,18(26)27)9-11-2-3-11/h4-5,8,11H,1-3,6-7,9-10H2,(H,20,23)(H,21,24)(H,26,27)/t19-/m0/s1 |
| InChIKey | JNKLDDUYOVTYDU-IBGZPJMESA-N |
| XLogP | 1.32 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|