C17H25FN4O2 — CID 97148212
[(3S)-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 97148212) has the molecular formula C17H25FN4O2 and a molecular weight of 336.41 g/mol. Its IUPAC name is [(3S)-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97148212 |
| Molecular Formula | C17H25FN4O2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [(3S)-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CC[C@@]1(CO)CCCN(c2ncc(F)c(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C17H25FN4O2/c1-2-4-17(13-23)5-3-6-22(12-17)16-19-11-14(18)15(20-16)21-7-9-24-10-8-21/h2,11,23H,1,3-10,12-13H2/t17-/m1/s1 |
| InChIKey | IFWQRYSIUQEVCX-QGZVFWFLSA-N |
| XLogP | 1.61 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|