C20H23N5O2 — CID 97149838
3-(1-methylpyrrol-2-yl)-N-[[(2S)-4-phenylmorpholin-2-yl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 97149838) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-(1-methylpyrrol-2-yl)-N-[[(2S)-4-phenylmorpholin-2-yl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1-methylpyrrol-2-yl)-N-[[(2S)-4-phenylmorpholin-2-yl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 97149838 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-(1-methylpyrrol-2-yl)-N-[[(2S)-4-phenylmorpholin-2-yl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cn1cccc1-c1cc(C(=O)NC[C@H]2CN(c3ccccc3)CCO2)[nH]n1 |
| InChI | InChI=1S/C20H23N5O2/c1-24-9-5-8-19(24)17-12-18(23-22-17)20(26)21-13-16-14-25(10-11-27-16)15-6-3-2-4-7-15/h2-9,12,16H,10-11,13-14H2,1H3,(H,21,26)(H,22,23)/t16-/m0/s1 |
| InChIKey | UIQRMLIIQKFSPN-INIZCTEOSA-N |
| XLogP | 2.05 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |