C23H33N3O2 — CID 97156784
(6R)-2-(cyclopropylmethyl)-8-[2-[4-(dimethylamino)phenyl]acetyl]-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 97156784) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (6R)-2-(cyclopropylmethyl)-8-[2-[4-(dimethylamino)phenyl]acetyl]-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6R)-2-(cyclopropylmethyl)-8-[2-[4-(dimethylamino)phenyl]acetyl]-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97156784 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (6R)-2-(cyclopropylmethyl)-8-[2-[4-(dimethylamino)phenyl]acetyl]-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CN(C)c1ccc(CC(=O)N2CCC[C@@]3(CCC(=O)N(CC4CC4)C3)C2)cc1 |
| InChI | InChI=1S/C23H33N3O2/c1-24(2)20-8-6-18(7-9-20)14-22(28)25-13-3-11-23(16-25)12-10-21(27)26(17-23)15-19-4-5-19/h6-9,19H,3-5,10-17H2,1-2H3/t23-/m1/s1 |
| InChIKey | JQUHRAKRZJNQEK-HSZRJFAPSA-N |
| XLogP | 2.94 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|