C17H23N3O — CID 99974497
(3R)-1-[2-[4-(dimethylamino)phenyl]acetyl]-3-methylpiperidine-3-carbonitrile (PubChem CID 99974497) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (3R)-1-[2-[4-(dimethylamino)phenyl]acetyl]-3-methylpiperidine-3-carbonitrile.
| Compound Name | (3R)-1-[2-[4-(dimethylamino)phenyl]acetyl]-3-methylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 99974497 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (3R)-1-[2-[4-(dimethylamino)phenyl]acetyl]-3-methylpiperidine-3-carbonitrile |
| SMILES | CN(C)c1ccc(CC(=O)N2CCC[C@@](C)(C#N)C2)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-17(12-18)9-4-10-20(13-17)16(21)11-14-5-7-15(8-6-14)19(2)3/h5-8H,4,9-11,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | LGBPRENGRBTBGF-KRWDZBQOSA-N |
| XLogP | 2.45 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|