About (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide
(2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 97157629) has the molecular formula C14H22N2OS
and a molecular weight of 266.41 g/mol. Its IUPAC name is (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide |
| PubChem CID | 97157629 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN1Cc1ccsc1 |
| InChI | InChI=1S/C14H22N2OS/c1-3-15(4-2)14(17)13-6-5-8-16(13)10-12-7-9-18-11-12/h7,9,11,13H,3-6,8,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | NAFORWHDHGBEMC-ZDUSSCGKSA-N |
| XLogP | 2.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide (CID 97157629) is (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide is CCN(CC)C(=O)[C@@H]1CCCN1Cc1ccsc1.
What is the InChIKey of (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide?
The InChIKey is NAFORWHDHGBEMC-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H22N2OS/c1-3-15(4-2)14(17)13-6-5-8-16(13)10-12-7-9-18-11-12/h7,9,11,13H,3-6,8,10H2,1-2H3/t13-/m0/s1.
What are the key properties of (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide?
(2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide has a molecular weight of 266.41 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-diethyl-1-(thiophen-3-ylmethyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 97157629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).