C13H19Cl2N3O — CID 97163874
2,4-dichloro-5-[3-[(3R)-piperidin-3-yl]propoxymethyl]pyrimidine (PubChem CID 97163874) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 2,4-dichloro-5-[3-[(3R)-piperidin-3-yl]propoxymethyl]pyrimidine.
| Compound Name | 2,4-dichloro-5-[3-[(3R)-piperidin-3-yl]propoxymethyl]pyrimidine |
|---|---|
| PubChem CID | 97163874 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2,4-dichloro-5-[3-[(3R)-piperidin-3-yl]propoxymethyl]pyrimidine |
| SMILES | Clc1ncc(COCCC[C@H]2CCCNC2)c(Cl)n1 |
| InChI | InChI=1S/C13H19Cl2N3O/c14-12-11(8-17-13(15)18-12)9-19-6-2-4-10-3-1-5-16-7-10/h8,10,16H,1-7,9H2/t10-/m1/s1 |
| InChIKey | JXOLCXIZVLZTIM-SNVBAGLBSA-N |
| XLogP | 3.08 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|