C11H16N2O2 — CID 97165678
1-(furan-2-yl)-2-[[(2R)-pyrrolidin-2-yl]methylamino]ethanone (PubChem CID 97165678) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[[(2R)-pyrrolidin-2-yl]methylamino]ethanone.
| Compound Name | 1-(furan-2-yl)-2-[[(2R)-pyrrolidin-2-yl]methylamino]ethanone |
|---|---|
| PubChem CID | 97165678 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(furan-2-yl)-2-[[(2R)-pyrrolidin-2-yl]methylamino]ethanone |
| SMILES | O=C(CNC[C@H]1CCCN1)c1ccco1 |
| InChI | InChI=1S/C11H16N2O2/c14-10(11-4-2-6-15-11)8-12-7-9-3-1-5-13-9/h2,4,6,9,12-13H,1,3,5,7-8H2/t9-/m1/s1 |
| InChIKey | OQWRUTHHBFJTNG-SECBINFHSA-N |
| XLogP | 0.80 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |