C10H11NO3 — CID 11608079
(5S)-5-[2-(furan-2-yl)-2-oxoethyl]pyrrolidin-2-one (PubChem CID 11608079) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (5S)-5-[2-(furan-2-yl)-2-oxoethyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-(furan-2-yl)-2-oxoethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11608079 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (5S)-5-[2-(furan-2-yl)-2-oxoethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CC(=O)c2ccco2)N1 |
| InChI | InChI=1S/C10H11NO3/c12-8(9-2-1-5-14-9)6-7-3-4-10(13)11-7/h1-2,5,7H,3-4,6H2,(H,11,13)/t7-/m0/s1 |
| InChIKey | CPYKXNTXHHYFKD-ZETCQYMHSA-N |
| XLogP | 1.13 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |