C19H27FN2O3 — CID 97167079
tert-butyl (2R)-2-[(3-fluorophenyl)methyl-methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 97167079) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3-fluorophenyl)methyl-methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3-fluorophenyl)methyl-methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97167079 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl (2R)-2-[(3-fluorophenyl)methyl-methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CN(Cc1cccc(F)c1)C(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27FN2O3/c1-19(2,3)25-18(24)22-11-6-5-10-16(22)17(23)21(4)13-14-8-7-9-15(20)12-14/h7-9,12,16H,5-6,10-11,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | IYSBXMDDSJEQGV-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |