C21H29ClN2O3 — CID 97173138
tert-butyl (2S)-2-[(4-chlorophenyl)methyl-cyclopropylcarbamoyl]piperidine-1-carboxylate (PubChem CID 97173138) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-chlorophenyl)methyl-cyclopropylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-chlorophenyl)methyl-cyclopropylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97173138 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl (2S)-2-[(4-chlorophenyl)methyl-cyclopropylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)N(Cc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-21(2,3)27-20(26)23-13-5-4-6-18(23)19(25)24(17-11-12-17)14-15-7-9-16(22)10-8-15/h7-10,17-18H,4-6,11-14H2,1-3H3/t18-/m0/s1 |
| InChIKey | QSMWYSAQOYQKJJ-SFHVURJKSA-N |
| XLogP | 4.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |