C21H31ClN2O3 — CID 97174826
tert-butyl (2R)-2-[(4-chlorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate (PubChem CID 97174826) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-chlorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(4-chlorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97174826 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl (2R)-2-[(4-chlorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)N(Cc1ccc(Cl)cc1)C(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31ClN2O3/c1-15(2)24(14-16-9-11-17(22)12-10-16)19(25)18-8-6-7-13-23(18)20(26)27-21(3,4)5/h9-12,15,18H,6-8,13-14H2,1-5H3/t18-/m1/s1 |
| InChIKey | QLMGDHUCZVAQSN-GOSISDBHSA-N |
| XLogP | 4.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |