C14H19F3N2 — CID 97168574
N-benzyl-1,1,1-trifluoro-N-[[(3R)-piperidin-3-yl]methyl]methanamine (PubChem CID 97168574) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-[[(3R)-piperidin-3-yl]methyl]methanamine.
| Compound Name | N-benzyl-1,1,1-trifluoro-N-[[(3R)-piperidin-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 97168574 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-[[(3R)-piperidin-3-yl]methyl]methanamine |
| SMILES | FC(F)(F)N(Cc1ccccc1)C[C@@H]1CCCNC1 |
| InChI | InChI=1S/C14H19F3N2/c15-14(16,17)19(10-12-5-2-1-3-6-12)11-13-7-4-8-18-9-13/h1-3,5-6,13,18H,4,7-11H2/t13-/m1/s1 |
| InChIKey | ZWMCOHBPYBYYIY-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|