C11H21BrN2 — CID 97168987
2-[(5R,8R)-8-(bromomethyl)-2-azaspiro[4.4]nonan-2-yl]ethanamine (PubChem CID 97168987) has the molecular formula C11H21BrN2 and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-[(5R,8R)-8-(bromomethyl)-2-azaspiro[4.4]nonan-2-yl]ethanamine.
| Compound Name | 2-[(5R,8R)-8-(bromomethyl)-2-azaspiro[4.4]nonan-2-yl]ethanamine |
|---|---|
| PubChem CID | 97168987 |
| Molecular Formula | C11H21BrN2 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(5R,8R)-8-(bromomethyl)-2-azaspiro[4.4]nonan-2-yl]ethanamine |
| SMILES | NCCN1CC[C@]2(CC[C@@H](CBr)C2)C1 |
| InChI | InChI=1S/C11H21BrN2/c12-8-10-1-2-11(7-10)3-5-14(9-11)6-4-13/h10H,1-9,13H2/t10-,11+/m1/s1 |
| InChIKey | GQXIEOFHMDDEKP-MNOVXSKESA-N |
| XLogP | 1.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|