C12H22BrN — CID 98083969
(5R,8R)-8-(bromomethyl)-2-propan-2-yl-2-azaspiro[4.4]nonane (PubChem CID 98083969) has the molecular formula C12H22BrN and a molecular weight of 260.22 g/mol. Its IUPAC name is (5R,8R)-8-(bromomethyl)-2-propan-2-yl-2-azaspiro[4.4]nonane.
| Compound Name | (5R,8R)-8-(bromomethyl)-2-propan-2-yl-2-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 98083969 |
| Molecular Formula | C12H22BrN |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (5R,8R)-8-(bromomethyl)-2-propan-2-yl-2-azaspiro[4.4]nonane |
| SMILES | CC(C)N1CC[C@]2(CC[C@@H](CBr)C2)C1 |
| InChI | InChI=1S/C12H22BrN/c1-10(2)14-6-5-12(9-14)4-3-11(7-12)8-13/h10-11H,3-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | SNWBPNGSQLARSR-NEPJUHHUSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|