C11H16N4O2 — CID 97176235
(2R)-4-(4,6-dimethylpyrimidin-2-yl)piperazine-2-carboxylic acid (PubChem CID 97176235) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2R)-4-(4,6-dimethylpyrimidin-2-yl)piperazine-2-carboxylic acid.
| Compound Name | (2R)-4-(4,6-dimethylpyrimidin-2-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97176235 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R)-4-(4,6-dimethylpyrimidin-2-yl)piperazine-2-carboxylic acid |
| SMILES | Cc1cc(C)nc(N2CCN[C@@H](C(=O)O)C2)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-7-5-8(2)14-11(13-7)15-4-3-12-9(6-15)10(16)17/h5,9,12H,3-4,6H2,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | DKEROXZHLOZANB-SECBINFHSA-N |
| XLogP | -0.04 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |