C14H21N5O3 — CID 56880424
4-[4-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazine-2-carboxylic acid (PubChem CID 56880424) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[4-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazine-2-carboxylic acid.
| Compound Name | 4-[4-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 56880424 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-[4-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2nccc(N3CCC(O)CC3)n2)CCN1 |
| InChI | InChI=1S/C14H21N5O3/c20-10-2-6-18(7-3-10)12-1-4-16-14(17-12)19-8-5-15-11(9-19)13(21)22/h1,4,10-11,15,20H,2-3,5-9H2,(H,21,22) |
| InChIKey | YXUHCILGEJRECZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |