About N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine
N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine (PubChem CID 97179144) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine |
| PubChem CID | 97179144 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccc(C)c(C)c1OC |
| InChI | InChI=1S/C13H19NO/c1-5-8-14-9-12-7-6-10(2)11(3)13(12)15-4/h5-7,14H,1,8-9H2,2-4H3 |
| InChIKey | GJEAFNSAGOIJJY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine?
The IUPAC name of N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine (CID 97179144) is N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine.
What is the SMILES notation for N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine?
The canonical SMILES for N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine is C=CCNCc1ccc(C)c(C)c1OC.
What is the InChIKey of N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine?
The InChIKey is GJEAFNSAGOIJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-5-8-14-9-12-7-6-10(2)11(3)13(12)15-4/h5-7,14H,1,8-9H2,2-4H3.
What are the key properties of N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine?
N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine has a molecular weight of 205.30 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methoxy-3,4-dimethylphenyl)methyl]prop-2-en-1-amine is sourced from PubChem (CID 97179144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).