C11H11F3O3 — CID 97180309
2-[(1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]acetic acid (PubChem CID 97180309) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-[(1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]acetic acid.
| Compound Name | 2-[(1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 97180309 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-[(1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]acetic acid |
| SMILES | Cc1ccc([C@@H](OCC(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O3/c1-7-2-4-8(5-3-7)10(11(12,13)14)17-6-9(15)16/h2-5,10H,6H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YOMDQDVFWTVOEX-SNVBAGLBSA-N |
| XLogP | 2.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |