C11H18N2O3 — CID 97181566
4-[[(2R)-oxiran-2-yl]methyl]-1-propanoyl-1,4-diazepan-5-one (PubChem CID 97181566) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[[(2R)-oxiran-2-yl]methyl]-1-propanoyl-1,4-diazepan-5-one.
| Compound Name | 4-[[(2R)-oxiran-2-yl]methyl]-1-propanoyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 97181566 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-[[(2R)-oxiran-2-yl]methyl]-1-propanoyl-1,4-diazepan-5-one |
| SMILES | CCC(=O)N1CCC(=O)N(C[C@@H]2CO2)CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-2-10(14)12-4-3-11(15)13(6-5-12)7-9-8-16-9/h9H,2-8H2,1H3/t9-/m1/s1 |
| InChIKey | XHUIRYUFYXTHDJ-SECBINFHSA-N |
| XLogP | -0.14 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|