C10H3BrCl2F3N — CID 97181858
3-bromo-2,4-dichloro-6-(trifluoromethyl)quinoline (PubChem CID 97181858) has the molecular formula C10H3BrCl2F3N and a molecular weight of 344.95 g/mol. Its IUPAC name is 3-bromo-2,4-dichloro-6-(trifluoromethyl)quinoline.
| Compound Name | 3-bromo-2,4-dichloro-6-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 97181858 |
| Molecular Formula | C10H3BrCl2F3N |
| Molecular Weight | 344.95 g/mol |
| Exact Mass | 342.88 |
| IUPAC Name | 3-bromo-2,4-dichloro-6-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1ccc2nc(Cl)c(Br)c(Cl)c2c1 |
| InChI | InChI=1S/C10H3BrCl2F3N/c11-7-8(12)5-3-4(10(14,15)16)1-2-6(5)17-9(7)13/h1-3H |
| InChIKey | YJVICKLIDRBOHR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|