C23H33NO3 — CID 97182483
(2R)-1-[2-hydroxyethyl-[3-[4-(phenoxymethyl)phenyl]propyl]amino]pentan-2-ol (PubChem CID 97182483) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (2R)-1-[2-hydroxyethyl-[3-[4-(phenoxymethyl)phenyl]propyl]amino]pentan-2-ol.
| Compound Name | (2R)-1-[2-hydroxyethyl-[3-[4-(phenoxymethyl)phenyl]propyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 97182483 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (2R)-1-[2-hydroxyethyl-[3-[4-(phenoxymethyl)phenyl]propyl]amino]pentan-2-ol |
| SMILES | CCC[C@@H](O)CN(CCO)CCCc1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H33NO3/c1-2-7-22(26)18-24(16-17-25)15-6-8-20-11-13-21(14-12-20)19-27-23-9-4-3-5-10-23/h3-5,9-14,22,25-26H,2,6-8,15-19H2,1H3/t22-/m1/s1 |
| InChIKey | COMNCEHONISSOD-JOCHJYFZSA-N |
| XLogP | 3.65 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |