C18H26N2O3 — CID 97193866
(E,2S)-2-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]hept-3-enoic acid (PubChem CID 97193866) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (E,2S)-2-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]hept-3-enoic acid.
| Compound Name | (E,2S)-2-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]hept-3-enoic acid |
|---|---|
| PubChem CID | 97193866 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (E,2S)-2-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]hept-3-enoic acid |
| SMILES | CCC/C=C/[C@@H](C(=O)O)N1CCC(OCc2ccccn2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-8-17(18(21)22)20-12-9-16(10-13-20)23-14-15-7-5-6-11-19-15/h4-8,11,16-17H,2-3,9-10,12-14H2,1H3,(H,21,22)/b8-4+/t17-/m0/s1 |
| InChIKey | SDVWRVOHGPRIMO-AUNFYEFLSA-N |
| XLogP | 2.87 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|