C16H24N4O2 — CID 97207949
(E,2R)-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)hept-3-enoic acid (PubChem CID 97207949) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (E,2R)-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)hept-3-enoic acid.
| Compound Name | (E,2R)-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)hept-3-enoic acid |
|---|---|
| PubChem CID | 97207949 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (E,2R)-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)hept-3-enoic acid |
| SMILES | CCC/C=C/[C@H](C(=O)O)N1CCCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-3-4-7-14(15(21)22)19-10-6-11-20(13-12-19)16-17-8-5-9-18-16/h4-5,7-9,14H,2-3,6,10-13H2,1H3,(H,21,22)/b7-4+/t14-/m1/s1 |
| InChIKey | MSFGVOZSYMVACK-BTKRWWFXSA-N |
| XLogP | 1.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|