About [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone
[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone (PubChem CID 97198787) has the molecular formula C17H29N5O
and a molecular weight of 319.45 g/mol. Its IUPAC name is [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone.
Molecular Properties
| Compound Name | [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone |
| PubChem CID | 97198787 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone |
| SMILES | CC(C)N1CCC[C@@H](C(=O)N2CCC(c3nncn3C)CC2)C1 |
| InChI | InChI=1S/C17H29N5O/c1-13(2)22-8-4-5-15(11-22)17(23)21-9-6-14(7-10-21)16-19-18-12-20(16)3/h12-15H,4-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | TYKFQUYCGGSGRT-OAHLLOKOSA-N |
| XLogP | 1.64 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone?
The IUPAC name of [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone (CID 97198787) is [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone.
What is the SMILES notation for [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone?
The canonical SMILES for [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone is CC(C)N1CCC[C@@H](C(=O)N2CCC(c3nncn3C)CC2)C1.
What is the InChIKey of [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone?
The InChIKey is TYKFQUYCGGSGRT-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H29N5O/c1-13(2)22-8-4-5-15(11-22)17(23)21-9-6-14(7-10-21)16-19-18-12-20(16)3/h12-15H,4-11H2,1-3H3/t15-/m1/s1.
What are the key properties of [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone?
[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone has a molecular weight of 319.45 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-[(3R)-1-propan-2-ylpiperidin-3-yl]methanone is sourced from PubChem (CID 97198787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).