C18H29N5O2 — CID 97277077
2-methyl-5-[4-[(3S)-1-propan-2-ylpiperidine-3-carbonyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 97277077) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-methyl-5-[4-[(3S)-1-propan-2-ylpiperidine-3-carbonyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-methyl-5-[4-[(3S)-1-propan-2-ylpiperidine-3-carbonyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 97277077 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-methyl-5-[4-[(3S)-1-propan-2-ylpiperidine-3-carbonyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | CC(C)N1CCC[C@H](C(=O)N2CCN(c3cnn(C)c(=O)c3)CC2)C1 |
| InChI | InChI=1S/C18H29N5O2/c1-14(2)23-6-4-5-15(13-23)18(25)22-9-7-21(8-10-22)16-11-17(24)20(3)19-12-16/h11-12,14-15H,4-10,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | RYLQXDNTSBKEGS-HNNXBMFYSA-N |
| XLogP | 0.55 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |