C25H26N2O2 — CID 97199846
(3R)-8-[[2-(furan-2-yl)phenyl]methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97199846) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (3R)-8-[[2-(furan-2-yl)phenyl]methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3R)-8-[[2-(furan-2-yl)phenyl]methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97199846 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (3R)-8-[[2-(furan-2-yl)phenyl]methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCN(Cc3ccccc3-c3ccco3)CC2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c28-24-22(19-7-2-1-3-8-19)17-25(26-24)12-14-27(15-13-25)18-20-9-4-5-10-21(20)23-11-6-16-29-23/h1-11,16,22H,12-15,17-18H2,(H,26,28)/t22-/m1/s1 |
| InChIKey | WYIJPVHFRGTZEW-JOCHJYFZSA-N |
| XLogP | 4.58 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |