C22H28N4O — CID 126449511
(3S)-8-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 126449511) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S)-8-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3S)-8-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 126449511 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (3S)-8-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | C=CCn1cc(CN2CCC3(CC2)C[C@@H](c2ccccc2)C(=O)N3)c(C)n1 |
| InChI | InChI=1S/C22H28N4O/c1-3-11-26-16-19(17(2)24-26)15-25-12-9-22(10-13-25)14-20(21(27)23-22)18-7-5-4-6-8-18/h3-8,16,20H,1,9-15H2,2H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | GXMIEJXPVLGHTO-FQEVSTJZSA-N |
| XLogP | 3.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|