C19H25N3S — CID 97201030
1-(1-methylpiperidin-4-yl)-3-[(1S)-1-naphthalen-2-ylethyl]thiourea (PubChem CID 97201030) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-3-[(1S)-1-naphthalen-2-ylethyl]thiourea.
| Compound Name | 1-(1-methylpiperidin-4-yl)-3-[(1S)-1-naphthalen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 97201030 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-3-[(1S)-1-naphthalen-2-ylethyl]thiourea |
| SMILES | C[C@H](NC(=S)NC1CCN(C)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H25N3S/c1-14(16-8-7-15-5-3-4-6-17(15)13-16)20-19(23)21-18-9-11-22(2)12-10-18/h3-8,13-14,18H,9-12H2,1-2H3,(H2,20,21,23)/t14-/m0/s1 |
| InChIKey | XDETZIIBQVCISZ-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|