C20H25N5O2 — CID 97204734
(3S)-N-[3-(benzotriazol-1-yl)propyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 97204734) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3S)-N-[3-(benzotriazol-1-yl)propyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(benzotriazol-1-yl)propyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97204734 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3S)-N-[3-(benzotriazol-1-yl)propyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCn1nnc2ccccc21)[C@H]1CCCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C20H25N5O2/c26-20(16-6-3-11-24(14-16)15-17-7-4-13-27-17)21-10-5-12-25-19-9-2-1-8-18(19)22-23-25/h1-2,4,7-9,13,16H,3,5-6,10-12,14-15H2,(H,21,26)/t16-/m0/s1 |
| InChIKey | VFKKSITWSMAESN-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|