C18H25ClN4O — CID 97206639
N-[(4-chloro-1-methylindazol-3-yl)methyl]-3-[(2S)-1-methylpiperidin-2-yl]propanamide (PubChem CID 97206639) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is N-[(4-chloro-1-methylindazol-3-yl)methyl]-3-[(2S)-1-methylpiperidin-2-yl]propanamide.
| Compound Name | N-[(4-chloro-1-methylindazol-3-yl)methyl]-3-[(2S)-1-methylpiperidin-2-yl]propanamide |
|---|---|
| PubChem CID | 97206639 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[(4-chloro-1-methylindazol-3-yl)methyl]-3-[(2S)-1-methylpiperidin-2-yl]propanamide |
| SMILES | CN1CCCC[C@H]1CCC(=O)NCc1nn(C)c2cccc(Cl)c12 |
| InChI | InChI=1S/C18H25ClN4O/c1-22-11-4-3-6-13(22)9-10-17(24)20-12-15-18-14(19)7-5-8-16(18)23(2)21-15/h5,7-8,13H,3-4,6,9-12H2,1-2H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | HOMFONZNNLDCDY-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |