C14H18ClN3O3S — CID 118795940
N-[(4-chloro-1-methylindazol-3-yl)methyl]-2-ethylsulfonylpropanamide (PubChem CID 118795940) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is N-[(4-chloro-1-methylindazol-3-yl)methyl]-2-ethylsulfonylpropanamide.
| Compound Name | N-[(4-chloro-1-methylindazol-3-yl)methyl]-2-ethylsulfonylpropanamide |
|---|---|
| PubChem CID | 118795940 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[(4-chloro-1-methylindazol-3-yl)methyl]-2-ethylsulfonylpropanamide |
| SMILES | CCS(=O)(=O)C(C)C(=O)NCc1nn(C)c2cccc(Cl)c12 |
| InChI | InChI=1S/C14H18ClN3O3S/c1-4-22(20,21)9(2)14(19)16-8-11-13-10(15)6-5-7-12(13)18(3)17-11/h5-7,9H,4,8H2,1-3H3,(H,16,19) |
| InChIKey | ZPYJKVROYYSNHZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |