C16H24ClN3O — CID 97208737
N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-3-[(3S)-1-methylpiperidin-3-yl]propanamide (PubChem CID 97208737) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-3-[(3S)-1-methylpiperidin-3-yl]propanamide.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-3-[(3S)-1-methylpiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 97208737 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-3-[(3S)-1-methylpiperidin-3-yl]propanamide |
| SMILES | CN1CCC[C@@H](CCC(=O)N(C)Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C16H24ClN3O/c1-19-9-3-4-13(11-19)6-8-16(21)20(2)12-14-5-7-15(17)18-10-14/h5,7,10,13H,3-4,6,8-9,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NSUDPFQSBLJDSB-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|