C19H25N3O — CID 97210921
6-[(2R)-2-(cyclohexylmethyl)pyrrolidine-1-carbonyl]-2-methylpyridine-3-carbonitrile (PubChem CID 97210921) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 6-[(2R)-2-(cyclohexylmethyl)pyrrolidine-1-carbonyl]-2-methylpyridine-3-carbonitrile.
| Compound Name | 6-[(2R)-2-(cyclohexylmethyl)pyrrolidine-1-carbonyl]-2-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97210921 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 6-[(2R)-2-(cyclohexylmethyl)pyrrolidine-1-carbonyl]-2-methylpyridine-3-carbonitrile |
| SMILES | Cc1nc(C(=O)N2CCC[C@@H]2CC2CCCCC2)ccc1C#N |
| InChI | InChI=1S/C19H25N3O/c1-14-16(13-20)9-10-18(21-14)19(23)22-11-5-8-17(22)12-15-6-3-2-4-7-15/h9-10,15,17H,2-8,11-12H2,1H3/t17-/m1/s1 |
| InChIKey | PGAHRJUTSGSABS-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |