C18H23N7 — CID 97212210
N-methyl-1-[(3S)-1-(7H-purin-6-yl)piperidin-3-yl]-N-(pyridin-3-ylmethyl)methanamine (PubChem CID 97212210) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is N-methyl-1-[(3S)-1-(7H-purin-6-yl)piperidin-3-yl]-N-(pyridin-3-ylmethyl)methanamine.
| Compound Name | N-methyl-1-[(3S)-1-(7H-purin-6-yl)piperidin-3-yl]-N-(pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 97212210 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-methyl-1-[(3S)-1-(7H-purin-6-yl)piperidin-3-yl]-N-(pyridin-3-ylmethyl)methanamine |
| SMILES | CN(Cc1cccnc1)C[C@@H]1CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C18H23N7/c1-24(9-14-4-2-6-19-8-14)10-15-5-3-7-25(11-15)18-16-17(21-12-20-16)22-13-23-18/h2,4,6,8,12-13,15H,3,5,7,9-11H2,1H3,(H,20,21,22,23)/t15-/m0/s1 |
| InChIKey | HINCOWMPVZMYTC-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |