C14H19N5O4 — CID 97212775
(5S)-5-ethyl-5-methyl-3-[3-[(3-nitro-2-pyridinyl)amino]propyl]imidazolidine-2,4-dione (PubChem CID 97212775) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is (5S)-5-ethyl-5-methyl-3-[3-[(3-nitro-2-pyridinyl)amino]propyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-5-methyl-3-[3-[(3-nitro-2-pyridinyl)amino]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97212775 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (5S)-5-ethyl-5-methyl-3-[3-[(3-nitro-2-pyridinyl)amino]propyl]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(C)NC(=O)N(CCCNc2ncccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C14H19N5O4/c1-3-14(2)12(20)18(13(21)17-14)9-5-8-16-11-10(19(22)23)6-4-7-15-11/h4,6-7H,3,5,8-9H2,1-2H3,(H,15,16)(H,17,21)/t14-/m0/s1 |
| InChIKey | IRNVWPSYOCZDCQ-AWEZNQCLSA-N |
| XLogP | 1.51 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|