C17H23NO3S — CID 97215677
methyl 2-[(3R)-4-(4-propan-2-ylbenzoyl)thiomorpholin-3-yl]acetate (PubChem CID 97215677) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is methyl 2-[(3R)-4-(4-propan-2-ylbenzoyl)thiomorpholin-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-4-(4-propan-2-ylbenzoyl)thiomorpholin-3-yl]acetate |
|---|---|
| PubChem CID | 97215677 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl 2-[(3R)-4-(4-propan-2-ylbenzoyl)thiomorpholin-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CSCCN1C(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-12(2)13-4-6-14(7-5-13)17(20)18-8-9-22-11-15(18)10-16(19)21-3/h4-7,12,15H,8-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | LQJIQYQFEJOJDC-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |