C17H23N3O3S — CID 97216029
(3R)-N-methyl-1-[2-(7-methyl-1H-indol-3-yl)acetyl]piperidine-3-sulfonamide (PubChem CID 97216029) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (3R)-N-methyl-1-[2-(7-methyl-1H-indol-3-yl)acetyl]piperidine-3-sulfonamide.
| Compound Name | (3R)-N-methyl-1-[2-(7-methyl-1H-indol-3-yl)acetyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97216029 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3R)-N-methyl-1-[2-(7-methyl-1H-indol-3-yl)acetyl]piperidine-3-sulfonamide |
| SMILES | CNS(=O)(=O)[C@@H]1CCCN(C(=O)Cc2c[nH]c3c(C)cccc23)C1 |
| InChI | InChI=1S/C17H23N3O3S/c1-12-5-3-7-15-13(10-19-17(12)15)9-16(21)20-8-4-6-14(11-20)24(22,23)18-2/h3,5,7,10,14,18-19H,4,6,8-9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | SJVPSCPVUMSMEZ-CQSZACIVSA-N |
| XLogP | 1.56 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |