C21H25N5O3 — CID 166214417
methyl 1-[1-[2-(7-ethyl-1H-indol-3-yl)acetyl]piperidin-3-yl]triazole-4-carboxylate (PubChem CID 166214417) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 1-[1-[2-(7-ethyl-1H-indol-3-yl)acetyl]piperidin-3-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[1-[2-(7-ethyl-1H-indol-3-yl)acetyl]piperidin-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 166214417 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | methyl 1-[1-[2-(7-ethyl-1H-indol-3-yl)acetyl]piperidin-3-yl]triazole-4-carboxylate |
| SMILES | CCc1cccc2c(CC(=O)N3CCCC(n4cc(C(=O)OC)nn4)C3)c[nH]c12 |
| InChI | InChI=1S/C21H25N5O3/c1-3-14-6-4-8-17-15(11-22-20(14)17)10-19(27)25-9-5-7-16(12-25)26-13-18(23-24-26)21(28)29-2/h4,6,8,11,13,16,22H,3,5,7,9-10,12H2,1-2H3 |
| InChIKey | NWMYTNLIJVAOJH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |