C17H20F2N2O — CID 97216355
N-[(S)-(2,4-difluorophenyl)-pyridin-3-ylmethyl]-2-ethoxy-N-methylethanamine (PubChem CID 97216355) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[(S)-(2,4-difluorophenyl)-pyridin-3-ylmethyl]-2-ethoxy-N-methylethanamine.
| Compound Name | N-[(S)-(2,4-difluorophenyl)-pyridin-3-ylmethyl]-2-ethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 97216355 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[(S)-(2,4-difluorophenyl)-pyridin-3-ylmethyl]-2-ethoxy-N-methylethanamine |
| SMILES | CCOCCN(C)[C@@H](c1cccnc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H20F2N2O/c1-3-22-10-9-21(2)17(13-5-4-8-20-12-13)15-7-6-14(18)11-16(15)19/h4-8,11-12,17H,3,9-10H2,1-2H3/t17-/m0/s1 |
| InChIKey | FBYLTFLUZAXYRQ-KRWDZBQOSA-N |
| XLogP | 3.42 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|