C19H22N2O2S — CID 97216568
(2S)-N-[(3-acetamidophenyl)methyl]-3-methylsulfanyl-2-phenylpropanamide (PubChem CID 97216568) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (2S)-N-[(3-acetamidophenyl)methyl]-3-methylsulfanyl-2-phenylpropanamide.
| Compound Name | (2S)-N-[(3-acetamidophenyl)methyl]-3-methylsulfanyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 97216568 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2S)-N-[(3-acetamidophenyl)methyl]-3-methylsulfanyl-2-phenylpropanamide |
| SMILES | CSC[C@H](C(=O)NCc1cccc(NC(C)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-14(22)21-17-10-6-7-15(11-17)12-20-19(23)18(13-24-2)16-8-4-3-5-9-16/h3-11,18H,12-13H2,1-2H3,(H,20,23)(H,21,22)/t18-/m0/s1 |
| InChIKey | IZDSWLABSXRUCV-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |