C16H26N4O3 — CID 97217656
N-cyclopropyl-2-[(3R)-3-[(4S)-1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]acetamide (PubChem CID 97217656) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3R)-3-[(4S)-1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[(3R)-3-[(4S)-1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97217656 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclopropyl-2-[(3R)-3-[(4S)-1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]acetamide |
| SMILES | CCN1C(=O)N[C@@](C)([C@@H]2CCCN(CC(=O)NC3CC3)C2)C1=O |
| InChI | InChI=1S/C16H26N4O3/c1-3-20-14(22)16(2,18-15(20)23)11-5-4-8-19(9-11)10-13(21)17-12-6-7-12/h11-12H,3-10H2,1-2H3,(H,17,21)(H,18,23)/t11-,16+/m1/s1 |
| InChIKey | JYWZEECPYZPRSG-BZNIZROVSA-N |
| XLogP | 0.31 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|