C15H22N4O3 — CID 97318217
(5R)-3-ethyl-5-methyl-5-[(3R)-1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 97318217) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (5R)-3-ethyl-5-methyl-5-[(3R)-1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-ethyl-5-methyl-5-[(3R)-1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97318217 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (5R)-3-ethyl-5-methyl-5-[(3R)-1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N[C@](C)([C@@H]2CCCN(Cc3ccon3)C2)C1=O |
| InChI | InChI=1S/C15H22N4O3/c1-3-19-13(20)15(2,16-14(19)21)11-5-4-7-18(9-11)10-12-6-8-22-17-12/h6,8,11H,3-5,7,9-10H2,1-2H3,(H,16,21)/t11-,15-/m1/s1 |
| InChIKey | ABSQCXNAFHRBHW-IAQYHMDHSA-N |
| XLogP | 1.22 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|