C15H25N7O2 — CID 97099056
(5R)-3,5-dimethyl-5-[(3S)-1-[(1-propyltetrazol-5-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 97099056) has the molecular formula C15H25N7O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (5R)-3,5-dimethyl-5-[(3S)-1-[(1-propyltetrazol-5-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3,5-dimethyl-5-[(3S)-1-[(1-propyltetrazol-5-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97099056 |
| Molecular Formula | C15H25N7O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (5R)-3,5-dimethyl-5-[(3S)-1-[(1-propyltetrazol-5-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | CCCn1nnnc1CN1CCC[C@H]([C@@]2(C)NC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C15H25N7O2/c1-4-7-22-12(17-18-19-22)10-21-8-5-6-11(9-21)15(2)13(23)20(3)14(24)16-15/h11H,4-10H2,1-3H3,(H,16,24)/t11-,15+/m0/s1 |
| InChIKey | UARBUPYKZSRRJL-XHDPSFHLSA-N |
| XLogP | 0.24 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|