C16H22N2O4 — CID 97218663
N-methyl-3-[(2R,5S)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide (PubChem CID 97218663) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-methyl-3-[(2R,5S)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide.
| Compound Name | N-methyl-3-[(2R,5S)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 97218663 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-methyl-3-[(2R,5S)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide |
| SMILES | C[C@H]1CC[C@H](CCC(=O)N(C)Cc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C16H22N2O4/c1-12-3-8-15(22-12)9-10-16(19)17(2)11-13-4-6-14(7-5-13)18(20)21/h4-7,12,15H,3,8-11H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | MXKLNUBQQPESSA-SWLSCSKDSA-N |
| XLogP | 2.90 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|