C16H25N5O4 — CID 97221018
2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[(1R,2R)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 97221018) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[(1R,2R)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[(1R,2R)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 97221018 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[(1R,2R)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)NC(=O)CN1CCN2C(=O)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H25N5O4/c1-10-4-2-3-5-11(10)17-15(24)18-13(22)9-20-6-7-21-12(8-20)14(23)19-16(21)25/h10-12H,2-9H2,1H3,(H,19,23,25)(H2,17,18,22,24)/t10-,11-,12+/m1/s1 |
| InChIKey | CLMMLGXNUPUTCL-UTUOFQBUSA-N |
| XLogP | -0.37 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|