C15H23NO4 — CID 97221199
3-(5-hydroxypentoxy)-N-[(2S)-2-hydroxypropyl]benzamide (PubChem CID 97221199) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 3-(5-hydroxypentoxy)-N-[(2S)-2-hydroxypropyl]benzamide.
| Compound Name | 3-(5-hydroxypentoxy)-N-[(2S)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 97221199 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-(5-hydroxypentoxy)-N-[(2S)-2-hydroxypropyl]benzamide |
| SMILES | C[C@H](O)CNC(=O)c1cccc(OCCCCCO)c1 |
| InChI | InChI=1S/C15H23NO4/c1-12(18)11-16-15(19)13-6-5-7-14(10-13)20-9-4-2-3-8-17/h5-7,10,12,17-18H,2-4,8-9,11H2,1H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | KKLULARKGOVBAQ-LBPRGKRZSA-N |
| XLogP | 1.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|