C18H27NO5 — CID 100761485
N-[(2S)-2-hydroxypropyl]-3-[3-[(2S)-oxan-2-yl]oxypropoxy]benzamide (PubChem CID 100761485) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-3-[3-[(2S)-oxan-2-yl]oxypropoxy]benzamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-3-[3-[(2S)-oxan-2-yl]oxypropoxy]benzamide |
|---|---|
| PubChem CID | 100761485 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-3-[3-[(2S)-oxan-2-yl]oxypropoxy]benzamide |
| SMILES | C[C@H](O)CNC(=O)c1cccc(OCCCO[C@H]2CCCCO2)c1 |
| InChI | InChI=1S/C18H27NO5/c1-14(20)13-19-18(21)15-6-4-7-16(12-15)22-10-5-11-24-17-8-2-3-9-23-17/h4,6-7,12,14,17,20H,2-3,5,8-11,13H2,1H3,(H,19,21)/t14-,17-/m0/s1 |
| InChIKey | GNTXMGHTLFVNJE-YOEHRIQHSA-N |
| XLogP | 2.11 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|