C60H86N2O18 — CID 10677722
methyl 3,5-bis[3-[[3,5-bis[3-(oxan-2-yloxy)propoxy]benzoyl]amino]propoxy]benzoate (PubChem CID 10677722) has the molecular formula C60H86N2O18 and a molecular weight of 1123.34 g/mol. Its IUPAC name is methyl 3,5-bis[3-[[3,5-bis[3-(oxan-2-yloxy)propoxy]benzoyl]amino]propoxy]benzoate.
| Compound Name | methyl 3,5-bis[3-[[3,5-bis[3-(oxan-2-yloxy)propoxy]benzoyl]amino]propoxy]benzoate |
|---|---|
| PubChem CID | 10677722 |
| Molecular Formula | C60H86N2O18 |
| Molecular Weight | 1123.34 g/mol |
| Exact Mass | 1122.59 |
| IUPAC Name | methyl 3,5-bis[3-[[3,5-bis[3-(oxan-2-yloxy)propoxy]benzoyl]amino]propoxy]benzoate |
| SMILES | COC(=O)c1cc(OCCCNC(=O)c2cc(OCCCOC3CCCCO3)cc(OCCCOC3CCCCO3)c2)cc(OCCCNC(=O)c2cc(OCCCOC3CCCCO3)cc(OCCCOC3CCCCO3)c2)c1 |
| InChI | InChI=1S/C60H86N2O18/c1-66-60(65)47-40-52(67-26-10-20-61-58(63)45-36-48(69-28-12-32-77-54-16-2-6-22-73-54)42-49(37-45)70-29-13-33-78-55-17-3-7-23-74-55)44-53(41-47)68-27-11-21-62-59(64)46-38-50(71-30-14-34-79-56-18-4-8-24-75-56)43-51(39-46)72-31-15-35-80-57-19-5-9-25-76-57/h36-44,54-57H,2-35H2,1H3,(H,61,63)(H,62,64) |
| InChIKey | STHPQMZKCQGGOM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1123.34 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|