C19H21N5O — CID 97224827
(3S,4R)-3-imidazol-1-yl-4-methyl-N-quinolin-8-ylpiperidine-1-carboxamide (PubChem CID 97224827) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is (3S,4R)-3-imidazol-1-yl-4-methyl-N-quinolin-8-ylpiperidine-1-carboxamide.
| Compound Name | (3S,4R)-3-imidazol-1-yl-4-methyl-N-quinolin-8-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97224827 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3S,4R)-3-imidazol-1-yl-4-methyl-N-quinolin-8-ylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1CCN(C(=O)Nc2cccc3cccnc23)C[C@H]1n1ccnc1 |
| InChI | InChI=1S/C19H21N5O/c1-14-7-10-23(12-17(14)24-11-9-20-13-24)19(25)22-16-6-2-4-15-5-3-8-21-18(15)16/h2-6,8-9,11,13-14,17H,7,10,12H2,1H3,(H,22,25)/t14-,17-/m1/s1 |
| InChIKey | MZSJXBWJPHOZQV-RHSMWYFYSA-N |
| XLogP | 3.55 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |